EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:91264 - 11(R)-HEPE
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC/C=C\C/C=C\C=C\[C@H](O)C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-7-10-13-16-19(21)17-14-11-8-6-9-12-15-18-20(22)23/h3-4,6-7,9-11,13-14,16,19,21H,2,5,8,12,15,17-18H2,1H3,(H,22,23)/b4-3-,9-6-,10-7-,14-11-,16-13+/t19-/m0/s1 |
| InChIKey | IDEHSDHMEMMYIR-DJWFCICMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11034610) | |
| Thalassiosira rotula (ncbitaxon:49265) | - | PubMed (16386769) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11(R)-HEPE (CHEBI:91264) has role algal metabolite (CHEBI:84735) |
| 11(R)-HEPE (CHEBI:91264) has role anti-inflammatory agent (CHEBI:67079) |
| 11(R)-HEPE (CHEBI:91264) has role human xenobiotic metabolite (CHEBI:76967) |
| 11(R)-HEPE (CHEBI:91264) is a 11-HEPE (CHEBI:131889) |
| 11(R)-HEPE (CHEBI:91264) is conjugate acid of 11(R)-HEPE(1−) (CHEBI:90820) |
| Incoming Relation(s) |
| 11(R)-HEPE(1−) (CHEBI:90820) is conjugate base of 11(R)-HEPE (CHEBI:91264) |
| IUPAC Name |
|---|
| (5Z,8Z,11R,12E,14Z,17Z)-11-hydroxyicosa-5,8,12,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (11R)-hydroxy-(5Z,8Z,12E,14Z,17Z)-icosapentaenoic acid | ChEBI |
| (11R)-hydroxy-(5Z,8Z,12E,14Z,17Z)-eicosapentaenoic acid | ChEBI |
| (5Z,8Z,11R,12E,14Z,17Z)-11-hydroxyicosapentaenoic acid | ChEBI |
| 11R-hydroxy-5Z,8Z,12E,14Z,17Z-eicosapentaenoic acid | LIPID MAPS |
| 11R-HEPE | HMDB |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070005 | LIPID MAPS |
| HMDB0012534 | HMDB |
| Citations |
|---|