EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CC/C=C\C/C=C\C=C\[C@H](O)C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-7-10-13-16-19(21)17-14-11-8-6-9-12-15-18-20(22)23/h3-4,6-7,9-11,13-14,16,19,21H,2,5,8,12,15,17-18H2,1H3,(H,22,23)/p-1/b4-3-,9-6-,10-7-,14-11-,16-13+/t19-/m0/s1 |
| InChIKey | IDEHSDHMEMMYIR-DJWFCICMSA-M |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11(R)-HEPE(1−) (CHEBI:90820) has role algal metabolite (CHEBI:84735) |
| 11(R)-HEPE(1−) (CHEBI:90820) has role anti-inflammatory agent (CHEBI:67079) |
| 11(R)-HEPE(1−) (CHEBI:90820) has role human xenobiotic metabolite (CHEBI:76967) |
| 11(R)-HEPE(1−) (CHEBI:90820) is a HEPE(1−) (CHEBI:131874) |
| 11(R)-HEPE(1−) (CHEBI:90820) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| 11(R)-HEPE(1−) (CHEBI:90820) is a icosanoid anion (CHEBI:62937) |
| 11(R)-HEPE(1−) (CHEBI:90820) is a long-chain fatty acid anion (CHEBI:57560) |
| 11(R)-HEPE(1−) (CHEBI:90820) is conjugate base of 11(R)-HEPE (CHEBI:91264) |
| Incoming Relation(s) |
| 11(R)-HEPE (CHEBI:91264) is conjugate acid of 11(R)-HEPE(1−) (CHEBI:90820) |
| IUPAC Name |
|---|
| (5Z,8Z,11R,12E,14Z,17Z)-11-hydroxyicosa-5,8,12,14,17-pentaenoate |
| Synonyms | Source |
|---|---|
| (11R)-hydroxy-(5Z,8Z,12E,14Z,17Z)-eicosapentaenoate | SUBMITTER |
| (11R)-hydroxy-(5Z,8Z,12E,14Z,17Z)-icosapentaenoate | ChEBI |
| (5Z,8Z,11R,12E,14Z,17Z)-11-hydroxyicosapentaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (11R)-hydroxy-(5Z,8Z,12E,14Z,17Z)-eicosapentaenoate | UniProt |
| Citations |
|---|