EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O10S |
| Net Charge | 0 |
| Average Mass | 452.437 |
| Monoisotopic Mass | 452.07772 |
| SMILES | COc1cc(C2Oc3c(OC)cc(/C=C/C(=O)O)cc3C2CO)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C20H20O10S/c1-27-16-9-12(4-5-15(16)30-31(24,25)26)19-14(10-21)13-7-11(3-6-18(22)23)8-17(28-2)20(13)29-19/h3-9,14,19,21H,10H2,1-2H3,(H,22,23)(H,24,25,26)/b6-3+ |
| InChIKey | VDMHTGWQLREBFW-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) has functional parent glycosmisic acid (CHEBI:91209) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) has role plant metabolite (CHEBI:76924) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a 1-benzofurans (CHEBI:38830) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a aryl sulfate (CHEBI:37919) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a guaiacyl lignin (CHEBI:64475) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a monomethoxybenzene (CHEBI:25235) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a primary alcohol (CHEBI:15734) |
| glycosmisic acid 4'-sulfate (CHEBI:91211) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-3-{3-(hydroxymethyl)-7-methoxy-2-[3-methoxy-4-(sulfooxy)phenyl]-2,3-dihydro-1-benzofuran-5-yl}prop-2-enoic acid |
| Synonym | Source |
|---|---|
| G(8-5)FA Sulfate | ChEBI |
| Citations |
|---|