EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O4 |
| Net Charge | 0 |
| Average Mass | 600.884 |
| Monoisotopic Mass | 600.41786 |
| SMILES | CC(/C=C/C=C(C)/C=C/C(=O)[C@]1(C)C[C@@H](O)CC1(C)C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35(43)38(9)27-33(41)25-36(38,5)6)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-24,33-34,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t33-,34-,38-,39+,40-/m0/s1 |
| InChIKey | QAILMWKAKHIIHL-CRBKEJBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asparagus officinalis (ncbitaxon:4686) | - | PubMed (11032480) | |
| Capsicum annuum (ncbitaxon:4072) | - | PubMed (20460582) | |
| Capsicum baccatum (ncbitaxon:33114) | - | PubMed (21535519) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsanthin 5,6-epoxide (CHEBI:91165) has functional parent capsanthin (CHEBI:3375) |
| capsanthin 5,6-epoxide (CHEBI:91165) has role plant metabolite (CHEBI:76924) |
| capsanthin 5,6-epoxide (CHEBI:91165) is a carotenone (CHEBI:35310) |
| capsanthin 5,6-epoxide (CHEBI:91165) is a epoxycarotenol (CHEBI:35307) |
| IUPAC Name |
|---|
| (3S,3'S,5R,5'R,6S)-3,3'-dihydroxy-5,6-dihydro-5,6-epoxy-β,κ-caroten-6'-one |
| UniProt Name | Source |
|---|---|
| (5R,6S)-5,6-epoxi-capsanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00023035 | KNApSAcK |
| CPD-7410 | MetaCyc |
| HMDB0036588 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4618987 | Reaxys |
| CAS:29486-21-3 | KNApSAcK |
| Citations |
|---|