EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O3 |
| Net Charge | 0 |
| Average Mass | 584.885 |
| Monoisotopic Mass | 584.42295 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C(=O)[C@]2(C)C[C@@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-23-36-33(5)25-34(41)26-38(36,6)7)15-11-12-16-30(2)18-14-20-32(4)22-24-37(43)40(10)28-35(42)27-39(40,8)9/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t34-,35+,40+/m1/s1 |
| InChIKey | VYIRVAXUEZSDNC-RDJLEWNRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsanthin (CHEBI:3375) has role plant metabolite (CHEBI:76924) |
| capsanthin (CHEBI:3375) is a carotenone (CHEBI:35310) |
| Incoming Relation(s) |
| capsanthin 5,6-epoxide (CHEBI:91165) has functional parent capsanthin (CHEBI:3375) |
| IUPAC Name |
|---|
| (3R,3'S,5'R)-3,3'-dihydroxy-β,κ-caroten-6'-one |
| Synonym | Source |
|---|---|
| Capsanthin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| all-trans-capsanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08584 | KEGG COMPOUND |
| LMPR01070265 | LIPID MAPS |
| CAPSANTHIN | MetaCyc |
| HMDB0036590 | HMDB |
| C00003763 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2493991 | Reaxys |
| CAS:465-42-9 | KEGG COMPOUND |
| CAS:465-42-9 | ChemIDplus |
| Citations |
|---|