EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@]23O[C@]2(C)C[C@@H](O)CC3(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56O2/c1-30(18-13-20-32(3)23-24-36-34(5)22-15-26-37(36,6)7)16-11-12-17-31(2)19-14-21-33(4)25-27-40-38(8,9)28-35(41)29-39(40,10)42-40/h11-14,16-21,23-25,27,35,41H,15,22,26,28-29H2,1-10H3/b12-11+,18-13+,19-14+,24-23+,27-25+,30-16+,31-17+,32-20+,33-21+/t35-,39+,40-/m0/s1 |
| InChIKey | CMOLUFWHADIFGS-VESOQFFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum annuum var. annuum (ncbitaxon:40321) | - | PubMed (24065101) | |
| Capsicum annuum (ncbitaxon:4072) | - | PubMed (8910532) | |
| Pouteria sapota (ncbitaxon:233744) | - | PubMed (26057604) | |
| Carica papaya (ncbitaxon:3649) | - | Article (IND20531516) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,5R,6S)-β-cryptoxanthin 5,6-epoxide (CHEBI:91143) has functional parent β-cryptoxanthin (CHEBI:10362) |
| (3S,5R,6S)-β-cryptoxanthin 5,6-epoxide (CHEBI:91143) has role plant metabolite (CHEBI:76924) |
| (3S,5R,6S)-β-cryptoxanthin 5,6-epoxide (CHEBI:91143) is a epoxycarotenol (CHEBI:35307) |
| IUPAC Name |
|---|
| (3S,5R,6S)-5,6-dihydro-5,6-epoxy-β,β-caroten-3-ol |
| Synonyms | Source |
|---|---|
| cryptoxanthin-5,6-epoxide | ChEBI |
| β-cryptoxanthin 5,6-epoxide | ChEBI |
| UniProt Name | Source |
|---|---|
| (5R,6S)-5,6-epoxi-β-cryptoxanthin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6757251 | Reaxys |
| Citations |
|---|