EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O |
| Net Charge | 0 |
| Average Mass | 552.887 |
| Monoisotopic Mass | 552.43312 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C[C@@H](O)CC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-21,23-26,36,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t36-/m1/s1 |
| InChIKey | DMASLKHVQRHNES-FKKUPVFPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | provitamin A A provitamin that can be converted into vitamin A by enzymes from animal tissues. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-cryptoxanthin (CHEBI:10362) has parent hydride β-carotene (CHEBI:17579) |
| β-cryptoxanthin (CHEBI:10362) has role antioxidant (CHEBI:22586) |
| β-cryptoxanthin (CHEBI:10362) has role biomarker (CHEBI:59163) |
| β-cryptoxanthin (CHEBI:10362) has role plant metabolite (CHEBI:76924) |
| β-cryptoxanthin (CHEBI:10362) has role provitamin A (CHEBI:67200) |
| β-cryptoxanthin (CHEBI:10362) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| (3S,5R,6S)-β-cryptoxanthin 5,6-epoxide (CHEBI:91143) has functional parent β-cryptoxanthin (CHEBI:10362) |
| IUPAC Name |
|---|
| (3R)-β,β-caroten-3-ol |
| Synonyms | Source |
|---|---|
| beta-Cryptoxanthin | KEGG COMPOUND |
| cryptoxanthin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| β-cryptoxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000920 | KNApSAcK |
| C08591 | KEGG COMPOUND |
| CPD-7409 | MetaCyc |
| Cryptoxanthin | Wikipedia |
| HMDB0033844 | HMDB |
| LMPR01070269 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2230123 | Reaxys |
| CAS:472-70-8 | KEGG COMPOUND |
| CAS:472-70-8 | ChemIDplus |
| Citations |
|---|