EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9O7P |
| Net Charge | 0 |
| Average Mass | 200.083 |
| Monoisotopic Mass | 200.00859 |
| SMILES | O=C(CO)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C4H9O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h4-5,7H,1-2H2,(H2,8,9,10)/t4-/m0/s1 |
| InChIKey | WUVPHPUDYOVMOE-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium smegmatis (ncbitaxon:1772) | - | PubMed (26560079) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythrulose 4-phosphate (CHEBI:91134) has functional parent L-erythrulose (CHEBI:27913) |
| L-erythrulose 4-phosphate (CHEBI:91134) has role bacterial metabolite (CHEBI:76969) |
| L-erythrulose 4-phosphate (CHEBI:91134) is a ketotetrose phosphate (CHEBI:24980) |
| L-erythrulose 4-phosphate (CHEBI:91134) is conjugate acid of L-erythrulose 4-phosphate(2−) (CHEBI:90798) |
| L-erythrulose 4-phosphate (CHEBI:91134) is enantiomer of D-erythrulose 4-phosphate (CHEBI:4116) |
| Incoming Relation(s) |
| L-erythrulose 4-phosphate(2−) (CHEBI:90798) is conjugate base of L-erythrulose 4-phosphate (CHEBI:91134) |
| D-erythrulose 4-phosphate (CHEBI:4116) is enantiomer of L-erythrulose 4-phosphate (CHEBI:91134) |
| IUPAC Name |
|---|
| (2S)-2,4-dihydroxy-3-oxobutyl dihydrogen phosphate |
| Citations |
|---|