EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O7P |
| Net Charge | -2 |
| Average Mass | 198.067 |
| Monoisotopic Mass | 197.99404 |
| SMILES | O=C(CO)[C@@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C4H9O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h4-5,7H,1-2H2,(H2,8,9,10)/p-2/t4-/m0/s1 |
| InChIKey | WUVPHPUDYOVMOE-BYPYZUCNSA-L |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythrulose 4-phosphate(2−) (CHEBI:90798) has role bacterial metabolite (CHEBI:76969) |
| L-erythrulose 4-phosphate(2−) (CHEBI:90798) is a organophosphate oxoanion (CHEBI:58945) |
| L-erythrulose 4-phosphate(2−) (CHEBI:90798) is conjugate base of L-erythrulose 4-phosphate (CHEBI:91134) |
| Incoming Relation(s) |
| L-erythrulose 4-phosphate (CHEBI:91134) is conjugate acid of L-erythrulose 4-phosphate(2−) (CHEBI:90798) |
| IUPAC Name |
|---|
| (2S)-2,4-dihydroxy-3-oxobutyl phosphate |
| UniProt Name | Source |
|---|---|
| L-erythrulose 4-phosphate | UniProt |
| Citations |
|---|