EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H38O20 |
| Net Charge | 0 |
| Average Mass | 862.746 |
| Monoisotopic Mass | 862.19564 |
| SMILES | [H][C@]1([C@@]2([H])c3cc(C(=O)O)cc(O)c3C(=O)c3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cccc32)c2cc(C(=O)O)cc(O)c2C(=O)c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc21 |
| InChI | InChI=1S/C42H38O20/c43-11-23-31(47)35(51)37(53)41(61-23)59-21-5-1-3-15-25(17-7-13(39(55)56)9-19(45)27(17)33(49)29(15)21)26-16-4-2-6-22(60-42-38(54)36(52)32(48)24(12-44)62-42)30(16)34(50)28-18(26)8-14(40(57)58)10-20(28)46/h1-10,23-26,31-32,35-38,41-48,51-54H,11-12H2,(H,55,56)(H,57,58)/t23-,24-,25-,26-,31-,32-,35+,36+,37-,38-,41-,42-/m1/s1 |
| InChIKey | IPQVTOJGNYVQEO-KGFNBKMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum rhabarbarum (ncbitaxon:333310) | - | Article (Chem. Pharm. Bull., 1974, v22(4), 823-831.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sennoside A (CHEBI:9112) is a oxo dicarboxylic acid (CHEBI:36145) |
| sennoside A (CHEBI:9112) is a sennosides (CHEBI:84154) |
| Incoming Relation(s) |
| sennoside (CHEBI:34974) has part sennoside A (CHEBI:9112) |
| IUPAC Name |
|---|
| (9R*,9'R*)-5,5'-bis(β-D-glucopyranosyloxy)-4,4'-dihydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid |
| Synonym | Source |
|---|---|
| (−)-(9R*,9'R*)-5,5'-bis(β-D-glucopyranosyloxy)-4,4'-dihydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10404 | KEGG COMPOUND |
| C00002863 | KNApSAcK |
| HMDB0034317 | HMDB |
| LMPK13040016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5723747 | Reaxys |
| CAS:81-27-6 | KEGG COMPOUND |
| CAS:81-27-6 | ChemIDplus |
| Citations |
|---|