EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H38O20 |
| Net Charge | 0 |
| Average Mass | 862.746 |
| Monoisotopic Mass | 862.19564 |
| SMILES | [H][C@]1([C@@]2([H])c3cc(C(=O)O)cc(O)c3C(=O)c3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cccc32)c2cc(C(=O)O)cc(O)c2C(=O)c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc21 |
| InChI | InChI=1S/C42H38O20/c43-11-23-31(47)35(51)37(53)41(61-23)59-21-5-1-3-15-25(17-7-13(39(55)56)9-19(45)27(17)33(49)29(15)21)26-16-4-2-6-22(60-42-38(54)36(52)32(48)24(12-44)62-42)30(16)34(50)28-18(26)8-14(40(57)58)10-20(28)46/h1-10,23-26,31-32,35-38,41-48,51-54H,11-12H2,(H,55,56)(H,57,58)/t23-,24-,25-,26-,31-,32-,35+,36+,37-,38-,41-,42-/m1/s1 |
| InChIKey | IPQVTOJGNYVQEO-KGFNBKMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum rhabarbarum (ncbitaxon:333310) | - | Article (Chem. Pharm. Bull., 1974, v22(4), 823-831.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sennoside A (CHEBI:9112) is a oxo dicarboxylic acid (CHEBI:36145) |
| sennoside A (CHEBI:9112) is a sennosides (CHEBI:84154) |
| Incoming Relation(s) |
| sennoside (CHEBI:34974) has part sennoside A (CHEBI:9112) |
| IUPAC Name |
|---|
| (9R*,9'R*)-5,5'-bis(β-D-glucopyranosyloxy)-4,4'-dihydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid |
| Synonym | Source |
|---|---|
| (−)-(9R*,9'R*)-5,5'-bis(β-D-glucopyranosyloxy)-4,4'-dihydroxy-10,10'-dioxo-9,9',10,10'-tetrahydro-9,9'-bianthracene-2,2'-dicarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002863 | KNApSAcK |
| C10404 | KEGG COMPOUND |
| HMDB0034317 | HMDB |
| LMPK13040016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5723747 | Reaxys |
| CAS:81-27-6 | ChemIDplus |
| CAS:81-27-6 | KEGG COMPOUND |
| Citations |
|---|