EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | N[C@H](Cc1ccccc1O)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-7(9(12)13)5-6-3-1-2-4-8(6)11/h1-4,7,11H,5,10H2,(H,12,13)/t7-/m1/s1 |
| InChIKey | WRFPVMFCRNYQNR-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS93) | ||
| - | PubMed (25502724) | ||
| - | MetaboLights (MTBLS124) | ||
| - | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-o-tyrosine (CHEBI:91041) has role human metabolite (CHEBI:77746) |
| D-o-tyrosine (CHEBI:91041) is a 2-hydroxyphenylalanine (CHEBI:91038) |
| D-o-tyrosine (CHEBI:91041) is enantiomer of L-o-tyrosine (CHEBI:91037) |
| Incoming Relation(s) |
| o-tyrosine (CHEBI:89461) has part D-o-tyrosine (CHEBI:91041) |
| L-o-tyrosine (CHEBI:91037) is enantiomer of D-o-tyrosine (CHEBI:91041) |
| IUPAC Name |
|---|
| 2-hydroxy-D-phenylalanine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(2-hydroxyphenyl)propanoic acid | ChEBI |
| D-2-Tyr | ChEBI |
| D-2-tyrosine | ChEBI |
| D-3-(2-hydroxyphenyl)alanine | ChEBI |
| D-3-(o-hydroxyphenyl)alanine | ChEBI |
| D-o-Tyr | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2416159 | Reaxys |