EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | NC(Cc1ccccc1O)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-7(9(12)13)5-6-3-1-2-4-8(6)11/h1-4,7,11H,5,10H2,(H,12,13) |
| InChIKey | WRFPVMFCRNYQNR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyphenylalanine (CHEBI:91038) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-hydroxyphenylalanine (CHEBI:91038) is a phenols (CHEBI:33853) |
| 2-hydroxyphenylalanine (CHEBI:91038) is a phenylalanine derivative (CHEBI:25985) |
| Incoming Relation(s) |
| D-o-tyrosine (CHEBI:91041) is a 2-hydroxyphenylalanine (CHEBI:91038) |
| L-o-tyrosine (CHEBI:91037) is a 2-hydroxyphenylalanine (CHEBI:91038) |
| IUPAC Name |
|---|
| 2-hydroxyphenylalanine |
| Synonym | Source |
|---|---|
| 2-amino-3-(2-hydroxyphenyl)propanoic acid | ChEBI |