EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | O=C(O)CCC/C=C\CC(O)/C=C/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C20H32O4/c21-18-14-10-6-4-2-1-3-5-7-11-15-19(22)16-12-8-9-13-17-20(23)24/h1-2,5,7-8,11-12,15,19,21-22H,3-4,6,9-10,13-14,16-18H2,(H,23,24)/b2-1-,7-5-,12-8-,15-11+ |
| InChIKey | AEHUQHOABRTKBQ-CXUYTRDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15364545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,20-DiHETE (CHEBI:90982) has functional parent 8-HETE (CHEBI:72643) |
| 8,20-DiHETE (CHEBI:90982) has role human xenobiotic metabolite (CHEBI:76967) |
| 8,20-DiHETE (CHEBI:90982) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| 8,20-DiHETE (CHEBI:90982) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 8,20-DiHETE (CHEBI:90982) is conjugate acid of 8,20-DiHETE(1−) (CHEBI:90717) |
| Incoming Relation(s) |
| 8,20-DiHETE(1−) (CHEBI:90717) is conjugate base of 8,20-DiHETE (CHEBI:90982) |
| IUPAC Name |
|---|
| (5Z,9E,11Z,14Z)-8,20-dihydroxyicosa-5,9,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9E,11Z,14Z)-8,20-dihydroxyicosatetraenoic acid | ChEBI |
| 8,20-dihydroxy-5Z,9E,11Z,14Z-eicosatetraenoic acid | ChEBI |
| 8,20-dihydroxy-5Z,9E,11Z,14Z-icosatetraenoic acid | ChEBI |
| Citations |
|---|