EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C(O)C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,14-11-,16-13+ |
| InChIKey | NLUNAYAEIJYXRB-HEJOTXCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-HETE (CHEBI:72643) has role mouse metabolite (CHEBI:75771) |
| 8-HETE (CHEBI:72643) is a HETE (CHEBI:36275) |
| 8-HETE (CHEBI:72643) is conjugate acid of 8-HETE(1−) (CHEBI:90716) |
| Incoming Relation(s) |
| 8,20-DiHETE (CHEBI:90982) has functional parent 8-HETE (CHEBI:72643) |
| 8-HETE(1−) (CHEBI:90716) is conjugate base of 8-HETE (CHEBI:72643) |
| IUPAC Name |
|---|
| (5Z,9E,11Z,14Z)-8-hydroxyicosa-5,9,11,14-tetraenoic acid |
| Synonym | Source |
|---|---|
| 8-hydroxy-5Z,9E,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060086 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4688094 | Reaxys |