EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | O=C(O)CCC[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)CCCCCO |
| InChI | InChI=1S/C20H32O6/c21-16-9-5-7-12-17(22)11-6-3-1-2-4-8-13-18(23)19(24)14-10-15-20(25)26/h1-4,6,8,11,13,17-19,21-24H,5,7,9-10,12,14-16H2,(H,25,26)/b3-1-,4-2+,11-6+,13-8+/t17-,18-,19+/m1/s1 |
| InChIKey | JGHYLPPTOXKEKH-HYQAYTNRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15364545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxylipoxin A4 (CHEBI:90976) has functional parent lipoxin A4 (CHEBI:6498) |
| 20-hydroxylipoxin A4 (CHEBI:90976) has role human xenobiotic metabolite (CHEBI:76967) |
| 20-hydroxylipoxin A4 (CHEBI:90976) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 20-hydroxylipoxin A4 (CHEBI:90976) is a lipoxin (CHEBI:6497) |
| 20-hydroxylipoxin A4 (CHEBI:90976) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 20-hydroxylipoxin A4 (CHEBI:90976) is conjugate acid of 20-hydroxylipoxin A4(1−) (CHEBI:90707) |
| Incoming Relation(s) |
| 20-hydroxylipoxin A4(1−) (CHEBI:90707) is conjugate base of 20-hydroxylipoxin A4 (CHEBI:90976) |
| IUPAC Name |
|---|
| ((5S,6R,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoate)-5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24406268 | Reaxys |
| Citations |
|---|