EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h4-7,9-10,13-14,17-19,21-23H,2-3,8,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,13-9+,14-10+/t17-,18+,19-/m0/s1 |
| InChIKey | IXAQOQZEOGMIQS-SSQFXEBMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoxin A4 (CHEBI:6498) has role human metabolite (CHEBI:77746) |
| lipoxin A4 (CHEBI:6498) has role metabolite (CHEBI:25212) |
| lipoxin A4 (CHEBI:6498) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| lipoxin A4 (CHEBI:6498) is a lipoxin (CHEBI:6497) |
| lipoxin A4 (CHEBI:6498) is a long-chain fatty acid (CHEBI:15904) |
| lipoxin A4 (CHEBI:6498) is conjugate acid of lipoxin A4(1−) (CHEBI:67026) |
| Incoming Relation(s) |
| 20-hydroxylipoxin A4 (CHEBI:90976) has functional parent lipoxin A4 (CHEBI:6498) |
| lipoxin A4(1−) (CHEBI:67026) is conjugate base of lipoxin A4 (CHEBI:6498) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z,13E,15S)-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| Lipoxin A4 | KEGG COMPOUND |
| LXA4 | KEGG COMPOUND |
| 5S,6R,15S-Trihydroxy-7E,9E,11Z,13E-eicosatetraenoic acid | KEGG COMPOUND |
| (7E,9E,11Z,13E)-(5S,6R,15S)-5,6,15-Trihydroxyicosa-7,9,11,13-tetraenoic acid | KEGG COMPOUND |
| LXA4 | ChEBI |
| 5S,6R-LipoxinA4 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C06314 | KEGG COMPOUND |
| LMFA03040001 | LIPID MAPS |
| HMDB0004385 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4698639 | Reaxys |
| Citations |
|---|