EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12NO5P |
| Net Charge | -2 |
| Average Mass | 221.149 |
| Monoisotopic Mass | 221.04641 |
| SMILES | CC(=O)N[C@@H](CCP(C)(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H14NO5P/c1-5(9)8-6(7(10)11)3-4-14(2,12)13/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)(H,12,13)/p-2/t6-/m0/s1 |
| InChIKey | VZVQOWUYAAWBCP-LURJTMIESA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-phosphinothricin(2−) (CHEBI:90940) is a N-acetylphosphinothricin(2−) (CHEBI:58879) |
| N-acetyl-L-phosphinothricin(2−) (CHEBI:90940) is conjugate base of N-acetyl-L-phosphinothricin (CHEBI:131436) |
| Incoming Relation(s) |
| N-acetyl-L-phosphinothricin (CHEBI:131436) is conjugate acid of N-acetyl-L-phosphinothricin(2−) (CHEBI:90940) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-4-(methylphosphinato)butanoate |
| UniProt Name | Source |
|---|---|
| N-acetyl-L-phosphinothricin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9999 | MetaCyc |
| Citations |
|---|