EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO5P |
| Net Charge | 0 |
| Average Mass | 223.165 |
| Monoisotopic Mass | 223.06096 |
| SMILES | CC(=O)N[C@@H](CCP(C)(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14NO5P/c1-5(9)8-6(7(10)11)3-4-14(2,12)13/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | VZVQOWUYAAWBCP-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-phosphinothricin (CHEBI:131436) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-phosphinothricin (CHEBI:131436) is a N-acetylphosphinothricin (CHEBI:52057) |
| N-acetyl-L-phosphinothricin (CHEBI:131436) is conjugate acid of N-acetyl-L-phosphinothricin(2−) (CHEBI:90940) |
| Incoming Relation(s) |
| N-acetyl-L-phosphinothricin(2−) (CHEBI:90940) is conjugate base of N-acetyl-L-phosphinothricin (CHEBI:131436) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-4-(methylphosphinato)butanoic acid |
| Synonyms | Source |
|---|---|
| L-N-Acetylphosphinothricin | KEGG COMPOUND |
| N-Acetyl-L-Glufosinate | KEGG COMPOUND |
| N-Acetylphinothricin | KEGG COMPOUND |
| N-Acetylphosphinothricin | KEGG COMPOUND |
| Citations |
|---|