EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90914 - uridine triacetate
| Formula | C15H18N2O9 |
| Net Charge | 0 |
| Average Mass | 370.314 |
| Monoisotopic Mass | 370.10123 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)nc2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H18N2O9/c1-7(18)23-6-10-12(24-8(2)19)13(25-9(3)20)14(26-10)17-5-4-11(21)16-15(17)22/h4-5,10,12-14H,6H2,1-3H3,(H,16,21,22)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | AUFUWRKPQLGTGF-FMKGYKFTSA-N |
| Roles Classification |
|---|
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine triacetate (CHEBI:90914) has role neuroprotective agent (CHEBI:63726) |
| uridine triacetate (CHEBI:90914) has role orphan drug (CHEBI:71031) |
| uridine triacetate (CHEBI:90914) has role prodrug (CHEBI:50266) |
| uridine triacetate (CHEBI:90914) is a acetate ester (CHEBI:47622) |
| uridine triacetate (CHEBI:90914) is a uridines (CHEBI:27242) |
| IUPAC Name |
|---|
| 2',3',5'-tri-O-acetyluridine |
| INN | Source |
|---|---|
| uridine triacetate | KEGG DRUG |
| Synonyms | Source |
|---|---|
| RG 2133 | ChemIDplus |
| Uridine 2',3',5'-triacetate | ChemIDplus |
| Triacetyluridine | ChemIDplus |
| PN 401 | ChemIDplus |
| Tri-O-acetyluridine | ChemIDplus |
| 2',3',5'-Triacetyluridine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Xuriden | KEGG DRUG |
| Citations |
|---|