EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90914 - uridine triacetate
| Formula | C15H18N2O9 |
| Net Charge | 0 |
| Average Mass | 370.314 |
| Monoisotopic Mass | 370.10123 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)nc2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H18N2O9/c1-7(18)23-6-10-12(24-8(2)19)13(25-9(3)20)14(26-10)17-5-4-11(21)16-15(17)22/h4-5,10,12-14H,6H2,1-3H3,(H,16,21,22)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | AUFUWRKPQLGTGF-FMKGYKFTSA-N |
| Roles Classification |
|---|
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uridine triacetate (CHEBI:90914) has role antineoplastic agent (CHEBI:35610) |
| uridine triacetate (CHEBI:90914) has role neuroprotective agent (CHEBI:63726) |
| uridine triacetate (CHEBI:90914) has role orphan drug (CHEBI:71031) |
| uridine triacetate (CHEBI:90914) has role prodrug (CHEBI:50266) |
| uridine triacetate (CHEBI:90914) is a acetate ester (CHEBI:47622) |
| uridine triacetate (CHEBI:90914) is a organic molecular entity (CHEBI:50860) |
| uridine triacetate (CHEBI:90914) is a pyrimidine nucleoside (CHEBI:26440) |
| uridine triacetate (CHEBI:90914) is a uridines (CHEBI:27242) |
| IUPAC Name |
|---|
| 2',3',5'-tri-O-acetyluridine |
| INNs | Source |
|---|---|
| triacetate d'uridine | WHO MedNet |
| triacetato de uridina | WHO MedNet |
| uridine triacetate | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2',3',5'-Triacetyluridine | ChemIDplus |
| PN 401 | ChemIDplus |
| PN-401 | ChEMBL |
| PN401 | ChemIDplus |
| RG 2133 | ChemIDplus |
| RG-2133 | ChEMBL |
| Brand Name | Source |
|---|---|
| Xuriden | KEGG DRUG |
| Citations |
|---|