EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O7 |
| Net Charge | 0 |
| Average Mass | 386.400 |
| Monoisotopic Mass | 386.13655 |
| SMILES | COc1cc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc3c(c2)OCO3)cc(O)c1OC |
| InChI | InChI=1S/C21H22O7/c1-24-19-9-13(7-16(22)20(19)25-2)6-15-14(10-26-21(15)23)5-12-3-4-17-18(8-12)28-11-27-17/h3-4,7-9,14-15,22H,5-6,10-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | PFCOJAPJHVVASV-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinopodophyllum hexandrum (ncbitaxon:93608) | - | PubMed (26359402) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-5'-desmethylyatein (CHEBI:90894) has functional parent (−)-bursehernin (CHEBI:90893) |
| (−)-5'-desmethylyatein (CHEBI:90894) has role plant metabolite (CHEBI:76924) |
| (−)-5'-desmethylyatein (CHEBI:90894) is a benzodioxoles (CHEBI:38298) |
| (−)-5'-desmethylyatein (CHEBI:90894) is a butan-4-olide (CHEBI:22950) |
| (−)-5'-desmethylyatein (CHEBI:90894) is a dimethoxybenzene (CHEBI:51681) |
| (−)-5'-desmethylyatein (CHEBI:90894) is a lignan (CHEBI:25036) |
| (−)-5'-desmethylyatein (CHEBI:90894) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (R,4R)-4-[(2H-1,3-benzodioxol-5-yl)methyl]-3-[(3-hydroxy-4,5-dimethoxyphenyl)methyl]oxolan-2-one |
| Synonyms | Source |
|---|---|
| 3-demethylyatein | ChEBI |
| (−)-3-desmethylyatein | ChEBI |
| UniProt Name | Source |
|---|---|
| (−)-5'-demethylyatein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18755 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4886287 | Reaxys |
| Citations |
|---|