EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1ccc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C21H22O6/c1-23-17-5-3-14(9-19(17)24-2)8-16-15(11-25-21(16)22)7-13-4-6-18-20(10-13)27-12-26-18/h3-6,9-10,15-16H,7-8,11-12H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | IYBDDRJHJMFFBB-JKSUJKDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bursera simaruba (ncbitaxon:80326) | bark (BTO:0001301) | PubMed (19329133) | |
| Stellera chamaejasme (ncbitaxon:142738) | root (BTO:0001188) | Article (Zhong cao yao = Chinese traditional and herbal drugs 2004, 35, 12-14) | |
| Bupleurum salicifolium (ncbitaxon:199751) | - | PubMed (24242108) | |
| Anthriscus sylvestris (ncbitaxon:48027) | root (BTO:0001188) | PubMed (10230514) | |
| Hernandia nymphaeifolia (ncbitaxon:121082) | - | PubMed (14987061) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-bursehernin (CHEBI:90893) has functional parent (−)-pluviatolide (CHEBI:90896) |
| (−)-bursehernin (CHEBI:90893) has role plant metabolite (CHEBI:76924) |
| (−)-bursehernin (CHEBI:90893) is a aromatic ether (CHEBI:35618) |
| (−)-bursehernin (CHEBI:90893) is a benzodioxoles (CHEBI:38298) |
| (−)-bursehernin (CHEBI:90893) is a butan-4-olide (CHEBI:22950) |
| (−)-bursehernin (CHEBI:90893) is a lignan (CHEBI:25036) |
| Incoming Relation(s) |
| (−)-5'-desmethylyatein (CHEBI:90894) has functional parent (−)-bursehernin (CHEBI:90893) |
| IUPAC Name |
|---|
| (3R,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| (−)-5'-desmethoxy-yatein | SUBMITTER |
| bursehernin | ChemIDplus |
| (R,R)-4-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxybenzyl)dihydrofuran-2(3H)-one | ChEBI |
| (3R-trans)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]dihydro-2(3H)-furanone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-bursehernin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3596448 | Reaxys |
| CAS:40456-51-7 | ChemIDplus |
| Citations |
|---|