EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21Cl2F3N5O12P3S2 |
| Net Charge | -4 |
| Average Mass | 772.334 |
| Monoisotopic Mass | 770.91921 |
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])C(Cl)(Cl)P(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25Cl2F3N5O12P3S2/c1-43-5-3-23-12-9-13(26-15(25-12)44-4-2-16(20,21)22)27(7-24-9)14-11(29)10(28)8(38-14)6-37-42(35,36)39-41(33,34)17(18,19)40(30,31)32/h7-8,10-11,14,28-29H,2-6H2,1H3,(H,33,34)(H,35,36)(H,23,25,26)(H2,30,31,32)/p-4/t8-,10-,11-,14-/m1/s1 |
| InChIKey | PAEBIVWUMLRPSK-IDTAVKCVSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cangrelor(4−) (CHEBI:90843) is a organophosphate oxoanion (CHEBI:58945) |
| cangrelor(4−) (CHEBI:90843) is a organophosphonate oxoanion (CHEBI:59635) |
| cangrelor(4−) (CHEBI:90843) is conjugate base of cangrelor (CHEBI:90841) |
| Incoming Relation(s) |
| cangrelor tetrasodium (CHEBI:90836) has part cangrelor(4−) (CHEBI:90843) |
| cangrelor (CHEBI:90841) is conjugate acid of cangrelor(4−) (CHEBI:90843) |
| IUPAC Name |
|---|
| 5'-O-[({[dichloro(phosphonato)methyl]phosphinato}oxy)phosphinato]-N-[2-(methylsulfanyl)ethyl]-2-[(3,3,3-trifluoropropyl)sulfanyl]adenosine |
| Synonyms | Source |
|---|---|
| cangrelor tetra-anion | ChEBI |
| cangrelor tetraanion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24729035 | Reaxys |