EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25Cl2F3N5O12P3S2 |
| Net Charge | 0 |
| Average Mass | 776.366 |
| Monoisotopic Mass | 774.94831 |
| SMILES | CSCCNc1nc(SCCC(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)C(Cl)(Cl)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H25Cl2F3N5O12P3S2/c1-43-5-3-23-12-9-13(26-15(25-12)44-4-2-16(20,21)22)27(7-24-9)14-11(29)10(28)8(38-14)6-37-42(35,36)39-41(33,34)17(18,19)40(30,31)32/h7-8,10-11,14,28-29H,2-6H2,1H3,(H,33,34)(H,35,36)(H,23,25,26)(H2,30,31,32)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | PAEBIVWUMLRPSK-IDTAVKCVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | P2Y12 receptor antagonist An antagonist at the P2Y12 receptor |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cangrelor (CHEBI:90841) has role P2Y12 receptor antagonist (CHEBI:68563) |
| cangrelor (CHEBI:90841) has role platelet aggregation inhibitor (CHEBI:50427) |
| cangrelor (CHEBI:90841) is a adenosine 5'-phosphate (CHEBI:37096) |
| cangrelor (CHEBI:90841) is a aryl sulfide (CHEBI:35683) |
| cangrelor (CHEBI:90841) is a nucleoside triphosphate analogue (CHEBI:37413) |
| cangrelor (CHEBI:90841) is a organochlorine compound (CHEBI:36683) |
| cangrelor (CHEBI:90841) is a organofluorine compound (CHEBI:37143) |
| cangrelor (CHEBI:90841) is a secondary amino compound (CHEBI:50995) |
| cangrelor (CHEBI:90841) is conjugate acid of cangrelor(4−) (CHEBI:90843) |
| Incoming Relation(s) |
| cangrelor(4−) (CHEBI:90843) is conjugate base of cangrelor (CHEBI:90841) |
| IUPAC Name |
|---|
| 5'-O-[({[dichloro(phosphono)methyl](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]-N-[2-(methylsulfanyl)ethyl]-2-[(3,3,3-trifluoropropyl)sulfanyl]adenosine |
| INN | Source |
|---|---|
| cangrelor | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8303713 | Reaxys |
| CAS:163706-06-7 | ChemIDplus |
| CAS:163706-06-7 | KEGG DRUG |
| Citations |
|---|