EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O5 |
| Net Charge | -1 |
| Average Mass | 353.479 |
| Monoisotopic Mass | 353.23335 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)[O-])[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18-14-19(17)25-24-18)10-7-4-5-8-11-20(22)23/h12-13,15-19,21H,2-11,14H2,1H3,(H,22,23)/p-1/b13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | NTAYABHEVAQSJS-CDIPTNKSSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10791960) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin H1(1−) (CHEBI:90793) has functional parent prostaglandin G1(1−) (CHEBI:133084) |
| prostaglandin H1(1−) (CHEBI:90793) has role human xenobiotic metabolite (CHEBI:76967) |
| prostaglandin H1(1−) (CHEBI:90793) is a oxylipin anion (CHEBI:62933) |
| prostaglandin H1(1−) (CHEBI:90793) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin H1(1−) (CHEBI:90793) is conjugate base of prostaglandin H1 (CHEBI:91133) |
| Incoming Relation(s) |
| prostaglandin H1 (CHEBI:91133) is conjugate acid of prostaglandin H1(1−) (CHEBI:90793) |
| IUPAC Name |
|---|
| 7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}heptanoate |
| UniProt Name | Source |
|---|---|
| prostaglandin H1 | UniProt |
| Citations |
|---|