EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O6 |
| Net Charge | -1 |
| Average Mass | 369.478 |
| Monoisotopic Mass | 369.22826 |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](CCCCCCC(=O)[O-])[C@@H]2C[C@H]1OO2)OO |
| InChI | InChI=1S/C20H34O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h12-13,15-19,23H,2-11,14H2,1H3,(H,21,22)/p-1/b13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | QXCRWNZYEVOQMB-CDIPTNKSSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin G1(1−) (CHEBI:133084) has role human metabolite (CHEBI:77746) |
| prostaglandin G1(1−) (CHEBI:133084) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin G1(1−) (CHEBI:133084) is conjugate base of prostaglandin G1 (CHEBI:133793) |
| Incoming Relation(s) |
| prostaglandin H1(1−) (CHEBI:90793) has functional parent prostaglandin G1(1−) (CHEBI:133084) |
| prostaglandin G1 (CHEBI:133793) is conjugate acid of prostaglandin G1(1−) (CHEBI:133084) |
| IUPAC Name |
|---|
| 7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroperoxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}heptanoate |
| UniProt Name | Source |
|---|---|
| prostaglandin G1 | UniProt |