EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N2O2 |
| Net Charge | +1 |
| Average Mass | 335.427 |
| Monoisotopic Mass | 335.17540 |
| SMILES | [H][C@@]12N3C(=O)C[C@]4([H])OCC=C5C[NH+]6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/p+1/t13-,16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | QMGVPVSNSZLJIA-FVWCLLPLSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine(1+) (CHEBI:90700) is a indole alkaloid cation (CHEBI:60521) |
| strychnine(1+) (CHEBI:90700) is conjugate acid of strychnine (CHEBI:28973) |
| Incoming Relation(s) |
| strychnine hydrochloride (CHEBI:90699) has part strychnine(1+) (CHEBI:90700) |
| strychnine (CHEBI:28973) is conjugate base of strychnine(1+) (CHEBI:90700) |
| IUPAC Name |
|---|
| 10-oxostrychnidin-19-ium |
| Synonyms | Source |
|---|---|
| strychnine cation | ChEBI |
| strychninium ion | ChEBI |
| UniProt Name | Source |
|---|---|
| strychnine | UniProt |