EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 370.880 |
| Monoisotopic Mass | 370.14481 |
| SMILES | Cl.[H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H22N2O2.ClH/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21;/h1-5,13,16-17,19-20H,6-11H2;1H/t13-,16-,17-,19-,20-,21+;/m0./s1 |
| InChIKey | VLXYTKMPCOQKEM-ZEYGOCRCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | glycine receptor antagonist An antagonist that blocks glycine receptors. neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | rodenticide A substance used to destroy rodent pests. neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. avicide A substance used to destroy bird pests (class Aves). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine hydrochloride (CHEBI:90699) has part strychnine(1+) (CHEBI:90700) |
| strychnine hydrochloride (CHEBI:90699) has role avicide (CHEBI:33289) |
| strychnine hydrochloride (CHEBI:90699) has role cholinergic antagonist (CHEBI:48873) |
| strychnine hydrochloride (CHEBI:90699) has role glycine receptor antagonist (CHEBI:62754) |
| strychnine hydrochloride (CHEBI:90699) has role neurotransmitter agent (CHEBI:35942) |
| strychnine hydrochloride (CHEBI:90699) has role rodenticide (CHEBI:33288) |
| strychnine hydrochloride (CHEBI:90699) is a hydrochloride (CHEBI:36807) |
| strychnine hydrochloride (CHEBI:90699) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 10-oxostrychnidin-19-ium chloride |
| strychnidin-10-one hydrochloride |
| Synonyms | Source |
|---|---|
| Strychnidin-10-one, monohydrochloride | ChemIDplus |
| Strychnine HCl | ChemIDplus |
| Strychnine, monohydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Strychnine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4927442 | Reaxys |
| CAS:1421-86-9 | ChemIDplus |