EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90699 - strychnine hydrochloride
| Formula | C21H22N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 370.880 |
| Monoisotopic Mass | 370.14481 |
| SMILES | Cl.[H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H22N2O2.ClH/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21;/h1-5,13,16-17,19-20H,6-11H2;1H/t13-,16-,17-,19-,20-,21+;/m0./s1 |
| InChIKey | VLXYTKMPCOQKEM-ZEYGOCRCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. glycine receptor antagonist An antagonist that blocks glycine receptors. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | neurotransmitter agent A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. rodenticide A substance used to destroy rodent pests. avicide A substance used to destroy bird pests (class Aves). cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine hydrochloride (CHEBI:90699) has part strychnine(1+) (CHEBI:90700) |
| strychnine hydrochloride (CHEBI:90699) has role avicide (CHEBI:33289) |
| strychnine hydrochloride (CHEBI:90699) has role cholinergic antagonist (CHEBI:48873) |
| strychnine hydrochloride (CHEBI:90699) has role glycine receptor antagonist (CHEBI:62754) |
| strychnine hydrochloride (CHEBI:90699) has role neurotransmitter agent (CHEBI:35942) |
| strychnine hydrochloride (CHEBI:90699) has role rodenticide (CHEBI:33288) |
| strychnine hydrochloride (CHEBI:90699) is a hydrochloride (CHEBI:36807) |
| strychnine hydrochloride (CHEBI:90699) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| strychnidin-10-one hydrochloride |
| 10-oxostrychnidin-19-ium chloride |
| Synonyms | Source |
|---|---|
| Strychnidin-10-one, monohydrochloride | ChemIDplus |
| Strychnine HCl | ChemIDplus |
| Strychnine, monohydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Strychnine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4927442 | Reaxys |
| CAS:1421-86-9 | ChemIDplus |