EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15ClN4.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 464.909 |
| Monoisotopic Mass | 464.12513 |
| SMILES | Clc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C20H15ClN4.C4H6O4/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14;5-3(6)1-2-4(7)8/h1-12H,13H2,(H,23,25);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | LLDWLPRYLVPDTG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vatalanib succinate (CHEBI:90623) has part vatalanib (CHEBI:90620) |
| vatalanib succinate (CHEBI:90623) has role angiogenesis inhibitor (CHEBI:48422) |
| vatalanib succinate (CHEBI:90623) has role antineoplastic agent (CHEBI:35610) |
| vatalanib succinate (CHEBI:90623) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| vatalanib succinate (CHEBI:90623) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| vatalanib succinate (CHEBI:90623) is a succinate salt (CHEBI:51381) |
| Synonyms | Source |
|---|---|
| CGP 79787D | ChemIDplus |
| PTK 787 | ChemIDplus |
| PTK-787 | ChemIDplus |
| PTK 787/ZK 222584 | ChemIDplus |
| PTK787/ZK222584 | ChemIDplus |
| vatalanib monosuccinate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Vatalanib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8664962 | Reaxys |
| CAS:212142-18-2 | ChemIDplus |
| Citations |
|---|