EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15ClN4 |
| Net Charge | 0 |
| Average Mass | 346.821 |
| Monoisotopic Mass | 346.09852 |
| SMILES | Clc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H15ClN4/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14/h1-12H,13H2,(H,23,25) |
| InChIKey | YCOYDOIWSSHVCK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vatalanib (CHEBI:90620) has role angiogenesis inhibitor (CHEBI:48422) |
| vatalanib (CHEBI:90620) has role antineoplastic agent (CHEBI:35610) |
| vatalanib (CHEBI:90620) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| vatalanib (CHEBI:90620) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| vatalanib (CHEBI:90620) is a monochlorobenzenes (CHEBI:83403) |
| vatalanib (CHEBI:90620) is a phthalazines (CHEBI:38768) |
| vatalanib (CHEBI:90620) is a pyridines (CHEBI:26421) |
| vatalanib (CHEBI:90620) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| vatalanib succinate (CHEBI:90623) has part vatalanib (CHEBI:90620) |
| IUPAC Name |
|---|
| N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| INNs | Source |
|---|---|
| vatalanib | WHO MedNet |
| vatalanib | WHO MedNet |
| vatalanib | WHO MedNet |
| vatalanib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CGP 79787 | ChemIDplus |
| CGP-79787 | ChemIDplus |
| N-(p-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine | ChEBI |
| N-(4-chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine | ChemIDplus |
| ZK-232934 | ChemIDplus |
| PTK787 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8638800 | Reaxys |
| CAS:212141-54-3 | ChemIDplus |
| Citations |
|---|