EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O3 |
| Net Charge | 0 |
| Average Mass | 258.277 |
| Monoisotopic Mass | 258.10044 |
| SMILES | N[C@@H](CC(=O)O)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H14N2O3/c15-12(8-13(17)18)14(19)16-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12H,8,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | YRMVHTZHFWHHIU-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) has role chromogenic compound (CHEBI:75050) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) is a N-(2-naphthyl)carboxamide (CHEBI:88330) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) is a L-aspartic acid derivative (CHEBI:83978) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) is a amino acid amide (CHEBI:22475) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) is conjugate acid of N-(α-L-aspartyl)-2-naphthylamine(1−) (CHEBI:90424) |
| Incoming Relation(s) |
| N-(α-L-aspartyl)-2-naphthylamine(1−) (CHEBI:90424) is conjugate base of N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) |
| IUPAC Name |
|---|
| N-naphthalen-2-yl-L-α-asparagine |
| Synonyms | Source |
|---|---|
| L-aspartic acid 2-naphthylamide | ChEBI |
| L-aspartic acid β-naphthylamide | ChEBI |
| Aspartic acid beta-naphthylamide | ChemIDplus |
| (S)-3-Amino-4-(2-naphthylamino)-4-oxobutyric acid | ChemIDplus |
| L-aspartic acid α-(2-naphthylamide) | ChEBI |
| L-aspartic acid 1-(2-naphthylamide) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8215544 | Reaxys |
| CAS:635-91-6 | ChemIDplus |