EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N2O3 |
| Net Charge | -1 |
| Average Mass | 257.269 |
| Monoisotopic Mass | 257.09317 |
| SMILES | N[C@@H](CC(=O)[O-])C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H14N2O3/c15-12(8-13(17)18)14(19)16-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12H,8,15H2,(H,16,19)(H,17,18)/p-1/t12-/m0/s1 |
| InChIKey | YRMVHTZHFWHHIU-LBPRGKRZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(α-L-aspartyl)-2-naphthylamine(1−) (CHEBI:90424) is a β-amino-acid anion (CHEBI:49095) |
| N-(α-L-aspartyl)-2-naphthylamine(1−) (CHEBI:90424) is conjugate base of N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) |
| Incoming Relation(s) |
| N-(α-L-aspartyl)-2-naphthylamine (CHEBI:90425) is conjugate acid of N-(α-L-aspartyl)-2-naphthylamine(1−) (CHEBI:90424) |
| IUPAC Name |
|---|
| (3S)-3-amino-4-[(naphthalen-2-yl)amino]-4-oxobutanoate |
| Synonyms | Source |
|---|---|
| L-aspartate β-naphthylamide | ChEBI |
| L-aspartate 2-naphthylamide | ChEBI |