EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13ClN2O |
| Net Charge | 0 |
| Average Mass | 248.713 |
| Monoisotopic Mass | 248.07164 |
| SMILES | NC(=O)[C@H]1CCCc2c1nc1ccc(Cl)cc21 |
| InChI | InChI=1S/C13H13ClN2O/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(15)17)12(8)16-11/h4-6,9,16H,1-3H2,(H2,15,17)/t9-/m0/s1 |
| InChIKey | FUZYTVDVLBBXDL-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Role: | Sir1 inhibitor An EC 3.5.1.98 (histone deacetylase) inhibitor that interferes with the action of Sir1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-selisistat (CHEBI:90371) has role Sir1 inhibitor (CHEBI:90375) |
| (S)-selisistat (CHEBI:90371) is a 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (CHEBI:90369) |
| (S)-selisistat (CHEBI:90371) is enantiomer of (R)-selisistat (CHEBI:90370) |
| Incoming Relation(s) |
| rac-selisistat (CHEBI:90196) has part (S)-selisistat (CHEBI:90371) |
| (R)-selisistat (CHEBI:90370) is enantiomer of (S)-selisistat (CHEBI:90371) |
| IUPAC Name |
|---|
| (1S)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| Synonyms | Source |
|---|---|
| EX-243 | ChEBI |
| EX-527 (S)-enantiomer | ChEBI |