EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90344 - N-methylproline
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | CN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | CWLQUGTUXBXTLF-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS222) | ||
| - | PubMed (25041144) | ||
| Tamarix jordanis (ncbitaxon:1112732) | - | PubMed (16359712) | |
| Citrus bergamia (ncbitaxon:380129) | |||
| fruit (BTO:0000486) | PubMed (21128667) | ||
| seed (BTO:0001226) | PubMed (21128667) | ||
| Castanea sativa (ncbitaxon:21020) | kernel (BTO:0000668) | PubMed (26593620) | |
| Casimiroa edulis (ncbitaxon:68535) | seed (BTO:0001226) | PubMed (10075120) | Methanol extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylproline (CHEBI:90344) has role human metabolite (CHEBI:77746) |
| N-methylproline (CHEBI:90344) has role plant metabolite (CHEBI:76924) |
| N-methylproline (CHEBI:90344) is a L-proline derivative (CHEBI:84186) |
| N-methylproline (CHEBI:90344) is a tertiary amino compound (CHEBI:50996) |
| N-methylproline (CHEBI:90344) is tautomer of N-methylproline zwitterion (CHEBI:133743) |
| Incoming Relation(s) |
| N-methylproline zwitterion (CHEBI:133743) is tautomer of N-methylproline (CHEBI:90344) |
| IUPAC Names |
|---|
| 1-methylproline |
| 1-methyl-L-proline |
| Synonyms | Source |
|---|---|
| N-methyl-L-proline | ChEBI |
| (2S)-1-methylpyrrolidine-2-carboxylic acid | PDBeChem |
| (−)-N-methyl-L-proline | KNApSAcK |
| Citations |
|---|