EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | C[NH+]1CCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | CWLQUGTUXBXTLF-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylproline zwitterion (CHEBI:133743) has role human metabolite (CHEBI:77746) |
| N-methylproline zwitterion (CHEBI:133743) has role plant metabolite (CHEBI:76924) |
| N-methylproline zwitterion (CHEBI:133743) is a L-α-amino acid zwitterion (CHEBI:59869) |
| N-methylproline zwitterion (CHEBI:133743) is tautomer of N-methylproline (CHEBI:90344) |
| Incoming Relation(s) |
| N-methylproline (CHEBI:90344) is tautomer of N-methylproline zwitterion (CHEBI:133743) |
| IUPAC Name |
|---|
| (2S)-1-methylpyrrolidin-1-ium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| N-methyl-L-proline | UniProt |