EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9NO2 |
| Net Charge | 0 |
| Average Mass | 187.198 |
| Monoisotopic Mass | 187.06333 |
| SMILES | O=C(O)/C=C/c1cc2ccccc2n1 |
| InChI | InChI=1S/C11H9NO2/c13-11(14)6-5-9-7-8-3-1-2-4-10(8)12-9/h1-7,12H,(H,13,14)/b6-5+ |
| InChIKey | SXOUIMVOMIGLHO-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS225) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-(indol-2-yl)acrylic acid (CHEBI:90333) has functional parent acrylic acid (CHEBI:18308) |
| (E)-3-(indol-2-yl)acrylic acid (CHEBI:90333) is a indoles (CHEBI:24828) |
| (E)-3-(indol-2-yl)acrylic acid (CHEBI:90333) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-3-(1H-indol-2-yl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-indoleacrylic acid | ChEBI |
| 2-indolylacrylic acid | ChEBI |
| 3-(2-indolyl)acrylic acid | ChEBI |
| indole-2-acrylic acid | ChEBI |
| indoleacrylic acid | ChEBI |
| trans-2-indoleacrylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000734 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4397595 | Reaxys |