EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15N3O6 |
| Net Charge | 0 |
| Average Mass | 393.355 |
| Monoisotopic Mass | 393.09609 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c([N+](=O)[O-])cccc3nc2-1 |
| InChI | InChI=1S/C20H15N3O6/c1-2-20(26)13-7-16-17-10(8-22(16)18(24)12(13)9-29-19(20)25)6-11-14(21-17)4-3-5-15(11)23(27)28/h3-7,26H,2,8-9H2,1H3/t20-/m0/s1 |
| InChIKey | VHXNKPBCCMUMSW-FQEVSTJZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubitecan (CHEBI:90225) has role antineoplastic agent (CHEBI:35610) |
| rubitecan (CHEBI:90225) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| rubitecan (CHEBI:90225) has role prodrug (CHEBI:50266) |
| rubitecan (CHEBI:90225) is a C-nitro compound (CHEBI:35716) |
| rubitecan (CHEBI:90225) is a pyranoindolizinoquinoline (CHEBI:48626) |
| rubitecan (CHEBI:90225) is a semisynthetic derivative (CHEBI:72588) |
| rubitecan (CHEBI:90225) is a tertiary alcohol (CHEBI:26878) |
| rubitecan (CHEBI:90225) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4S)-4-ethyl-4-hydroxy-10-nitro-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| INNs | Source |
|---|---|
| rubitecan | ChemIDplus |
| rubitecán | WHO MedNet |
| rubitécan | WHO MedNet |
| rubitecanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 9-NC | ChemIDplus |
| 9-nitro-(20S)-camptothecin | ChEBI |
| 9-nitro-20(S)-camptothecin | ChemIDplus |
| 9-nitro-20-(s)-camptothecin | ChEMBL |
| 9-nitrocamptothecin | ChemIDplus |
| RFS 2000 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Camptogen | ChemIDplus |
| Orathecin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5365063 | Reaxys |
| CAS:91421-42-0 | ChemIDplus |
| CAS:91421-42-0 | KEGG DRUG |
| Citations |
|---|