EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N4O8S2 |
| Net Charge | 0 |
| Average Mass | 480.480 |
| Monoisotopic Mass | 480.04096 |
| SMILES | CC(=O)Nc1ccc(N=Nc2c(N)ccc3cc(S(=O)(=O)O)cc(O)c23)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H16N4O8S2/c1-9(23)20-11-3-5-14(16(7-11)32(28,29)30)21-22-18-13(19)4-2-10-6-12(31(25,26)27)8-15(24)17(10)18/h2-8,24H,19H2,1H3,(H,20,23)(H,25,26,27)(H,28,29,30) |
| InChIKey | IJPUPVHRAZCFRI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine fast red (acid form) (CHEBI:90204) has role fluorochrome (CHEBI:51217) |
| lissamine fast red (acid form) (CHEBI:90204) has role histological dye (CHEBI:77178) |
| lissamine fast red (acid form) (CHEBI:90204) is a acetamides (CHEBI:22160) |
| lissamine fast red (acid form) (CHEBI:90204) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| lissamine fast red (acid form) (CHEBI:90204) is a azobenzenes (CHEBI:22682) |
| lissamine fast red (acid form) (CHEBI:90204) is a naphthols (CHEBI:25392) |
| lissamine fast red (acid form) (CHEBI:90204) is conjugate acid of lissamine fast red(2−) (CHEBI:90202) |
| Incoming Relation(s) |
| lissamine fast red(2−) (CHEBI:90202) is conjugate base of lissamine fast red (acid form) (CHEBI:90204) |
| IUPAC Name |
|---|
| 5-[(4-acetamido-2-sulfophenyl)diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| Lissamine fast red free acid | ChEBI |
| 5-((4-Acetamido-2-sulphonatophenyl)azo)-6-amino-4-hydroxynaphthalene-2-sulphonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:25317-34-4 | ChemIDplus |