EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9N3O4 |
| Net Charge | 0 |
| Average Mass | 175.144 |
| Monoisotopic Mass | 175.05931 |
| SMILES | N=C(N)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9N3O4/c6-5(7)8-2(4(11)12)1-3(9)10/h2H,1H2,(H,9,10)(H,11,12)(H4,6,7,8) |
| InChIKey | VVHOUVWJCQOYGG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-amidinoaspartic acid (CHEBI:90143) is a aspartic acid derivative (CHEBI:22661) |
| N-amidinoaspartic acid (CHEBI:90143) is a dicarboxylic acid (CHEBI:35692) |
| N-amidinoaspartic acid (CHEBI:90143) is a guanidines (CHEBI:24436) |
| Incoming Relation(s) |
| N-amidino-L-aspartic acid (CHEBI:17072) is a N-amidinoaspartic acid (CHEBI:90143) |
| IUPAC Name |
|---|
| N-carbamimidoylaspartic acid |
| Synonym | Source |
|---|---|
| guanidinosuccinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726857 | Reaxys |