EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9014 - salsalate
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | O=C(Oc1ccccc1C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C14H10O5/c15-11-7-3-1-5-9(11)14(18)19-12-8-4-2-6-10(12)13(16)17/h1-8,15H,(H,16,17) |
| InChIKey | WVYADZUPLLSGPU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. hypoglycemic agent A drug which lowers the blood glucose level. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salsalate (CHEBI:9014) has functional parent salicylic acid (CHEBI:16914) |
| salsalate (CHEBI:9014) has role antineoplastic agent (CHEBI:35610) |
| salsalate (CHEBI:9014) has role antirheumatic drug (CHEBI:35842) |
| salsalate (CHEBI:9014) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| salsalate (CHEBI:9014) has role hypoglycemic agent (CHEBI:35526) |
| salsalate (CHEBI:9014) has role non-narcotic analgesic (CHEBI:35481) |
| salsalate (CHEBI:9014) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| salsalate (CHEBI:9014) has role prodrug (CHEBI:50266) |
| salsalate (CHEBI:9014) is a benzoate ester (CHEBI:36054) |
| salsalate (CHEBI:9014) is a benzoic acids (CHEBI:22723) |
| salsalate (CHEBI:9014) is a phenols (CHEBI:33853) |
| salsalate (CHEBI:9014) is a salicylates (CHEBI:26596) |
| IUPAC Name |
|---|
| 2-[(2-hydroxybenzoyl)oxy]benzoic acid |
| INNs | Source |
|---|---|
| salsalate | KEGG DRUG |
| salsalatum | DrugBank |
| salsalato | ChemIDplus |
| salsalate | WHO MedNet |
| Synonyms | Source |
|---|---|
| Sasapyrine | KEGG DRUG |
| salicylsalicylic acid | DrugBank |
| o-Salicylsalicylic acid | ChemIDplus |
| O-Salicylcylsalicylsäure | ChemIDplus |
| Sasapyrinum | ChemIDplus |
| Sasapyrin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Disalcid | KEGG DRUG |
| Citations |
|---|