EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | Cc1cc(C)c(CC(N)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-7-4-8(2)10(9(3)5-7)6-11(13)12(14)15/h4-5,11H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | CRNOZLNQYAUXRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS87) | ||
| - | MetaboLights (MTBLS88) | ||
| - | DOI (10.1371/journal.pone.0115359) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trimethylphenylalanine (CHEBI:90135) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2,4,6-trimethylphenylalanine (CHEBI:90135) is a phenylalanine derivative (CHEBI:25985) |
| Incoming Relation(s) |
| D-2,4,6-trimethylphenylalanine (CHEBI:110424) is a 2,4,6-trimethylphenylalanine (CHEBI:90135) |
| L-2,4,6-trimethylphenylalanine (CHEBI:110390) is a 2,4,6-trimethylphenylalanine (CHEBI:90135) |
| IUPAC Name |
|---|
| 2,4,6-trimethylphenylalanine |
| Synonym | Source |
|---|---|
| 2-amino-3-(2,4,6-trimethylphenyl)propanoic acid | IUPAC |