EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | Cc1cc(C)c(C[C@@H](N)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-7-4-8(2)10(9(3)5-7)6-11(13)12(14)15/h4-5,11H,6,13H2,1-3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | CRNOZLNQYAUXRK-LLVKDONJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-2,4,6-trimethylphenylalanine (CHEBI:110424) is a D-phenylalanine derivative (CHEBI:84143) |
| D-2,4,6-trimethylphenylalanine (CHEBI:110424) is a 2,4,6-trimethylphenylalanine (CHEBI:90135) |
| D-2,4,6-trimethylphenylalanine (CHEBI:110424) is enantiomer of L-2,4,6-trimethylphenylalanine (CHEBI:110390) |
| Incoming Relation(s) |
| 2,4,6-trimethyl-DL-phenylalanine (CHEBI:110552) has part D-2,4,6-trimethylphenylalanine (CHEBI:110424) |
| L-2,4,6-trimethylphenylalanine (CHEBI:110390) is enantiomer of D-2,4,6-trimethylphenylalanine (CHEBI:110424) |
| IUPAC Name |
|---|
| 2,4,6-trimethyl-D-phenylalanine |
| Synonym | Source |
|---|---|
| (2R)-2-amino-3-(2,4,6-trimethylphenyl)propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11282764 | Reaxys |