EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H35N2O6S2 |
| Net Charge | -1 |
| Average Mass | 667.829 |
| Monoisotopic Mass | 667.19420 |
| SMILES | CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)[O-])c3)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H36N2O6S2/c1-3-38(26-28-10-8-14-35(24-28)46(40,41)42)33-20-16-31(17-21-33)37(30-12-6-5-7-13-30)32-18-22-34(23-19-32)39(4-2)27-29-11-9-15-36(25-29)47(43,44)45/h5-25H,3-4,26-27H2,1-2H3,(H-,40,41,42,43,44,45)/p-1 |
| InChIKey | SRRJCDUOSQWHGS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guinee green B(1−) (CHEBI:90115) is a organosulfonate oxoanion (CHEBI:33554) |
| Guinee green B(1−) (CHEBI:90115) is conjugate base of Guinee green B(1+) (CHEBI:90114) |
| Incoming Relation(s) |
| Guinee green B (CHEBI:90112) has part Guinee green B(1−) (CHEBI:90115) |
| Guinee green B(1+) (CHEBI:90114) is conjugate acid of Guinee green B(1−) (CHEBI:90115) |
| IUPAC Name |
|---|
| 3-[(ethyl{4-[(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene}azaniumyl)methyl]benzene-1-sulfonate |