EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H35N2O6S2.Na |
| Net Charge | 0 |
| Average Mass | 690.819 |
| Monoisotopic Mass | 690.18342 |
| SMILES | CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)[O-])c3)C=C2)c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C37H36N2O6S2.Na/c1-3-38(26-28-10-8-14-35(24-28)46(40,41)42)33-20-16-31(17-21-33)37(30-12-6-5-7-13-30)32-18-22-34(23-19-32)39(4-2)27-29-11-9-15-36(25-29)47(43,44)45;/h5-25H,3-4,26-27H2,1-2H3,(H-,40,41,42,43,44,45);/q;+1/p-1 |
| InChIKey | XKTMIJODWOEBKO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guinee green B (CHEBI:90112) has part Guinee green B(1−) (CHEBI:90115) |
| Guinee green B (CHEBI:90112) has role fluorochrome (CHEBI:51217) |
| Guinee green B (CHEBI:90112) has role food colouring (CHEBI:77182) |
| Guinee green B (CHEBI:90112) has role histological dye (CHEBI:77178) |
| Guinee green B (CHEBI:90112) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3-[(ethyl{4-[(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)(phenyl)methylidene]cyclohexa-2,5-dien-1-ylidene}azaniumyl)methyl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Acid green 3 | ChEBI |
| C.I. 42085 | ChEBI |
| C.I. Acid Green 3 | ChemIDplus |
| C.I. Acid Green 3, monosodium salt | ChemIDplus |
| C.I. Acid Green 3, sodium salt | ChemIDplus |
| C.I. Food Green 1 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18635422 | Reaxys |
| Reaxys:5716108 | Reaxys |
| CAS:4680-78-8 | ChemIDplus |
| Citations |
|---|