EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9008 - salicyluric acid
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)CNC(=O)c1ccccc1O |
| InChI | InChI=1S/C9H9NO4/c11-7-4-2-1-3-6(7)9(14)10-5-8(12)13/h1-4,11H,5H2,(H,10,14)(H,12,13) |
| InChIKey | ONJSZLXSECQROL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. uremic toxin A toxin that accumulates in patients with chronic kidney disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salicyluric acid (CHEBI:9008) has functional parent glycine (CHEBI:15428) |
| salicyluric acid (CHEBI:9008) has role human xenobiotic metabolite (CHEBI:76967) |
| salicyluric acid (CHEBI:9008) has role uremic toxin (CHEBI:64584) |
| salicyluric acid (CHEBI:9008) is a N-acylglycine (CHEBI:16180) |
| salicyluric acid (CHEBI:9008) is a secondary carboxamide (CHEBI:140325) |
| salicyluric acid (CHEBI:9008) is conjugate acid of salicylurate (CHEBI:132923) |
| Incoming Relation(s) |
| 5-aminosalicyluric acid (CHEBI:68589) has functional parent salicyluric acid (CHEBI:9008) |
| salicyluric β-D-glucuronide (CHEBI:133026) has functional parent salicyluric acid (CHEBI:9008) |
| salicylurate (CHEBI:132923) is conjugate base of salicyluric acid (CHEBI:9008) |
| IUPAC Names |
|---|
| (2-hydroxybenzamido)acetic acid |
| N-(2-hydroxybenzoyl)glycine |
| Synonyms | Source |
|---|---|
| Salicyluric acid | KEGG COMPOUND |
| Salicylurate | KEGG COMPOUND |
| N-(2-Hydroxybenzoyl)-glycine | KEGG COMPOUND |
| N-Salicyloylglycine | ChemIDplus |
| Salicyloylglycine | ChemIDplus |
| o-Hydroxyhippuric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07588 | KEGG COMPOUND |
| HMDB0000840 | HMDB |
| Salicyluric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213833 | Reaxys |
| CAS:487-54-7 | KEGG COMPOUND |
| CAS:487-54-7 | ChemIDplus |
| Citations |
|---|