EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3 |
| Net Charge | 0 |
| Average Mass | 126.111 |
| Monoisotopic Mass | 126.03169 |
| SMILES | Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C6H6O3/c1-4-2-3-5(9-4)6(7)8/h2-3H,1H3,(H,7,8) |
| InChIKey | OVOCLWJUABOAPL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2338430) | |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (19035407) | Identified in the urine of Sprague-Dawley rats. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methylfuran-2-carboxylic acid (CHEBI:89918) has role human urinary metabolite (CHEBI:84087) |
| 5-methylfuran-2-carboxylic acid (CHEBI:89918) has role rat metabolite (CHEBI:86264) |
| 5-methylfuran-2-carboxylic acid (CHEBI:89918) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-methylfuran-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-methylpyromucic acid | ChemIDplus |
| 5-methyl-2-furoic acid | ChEBI |
| 5-methyl-2-furancarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059735 | HMDB |
| 2K1 | PDBeChem |
| 67283 | ChemSpider |
| WO2012024353 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1917-15-3 | ChemIDplus |
| Citations |
|---|