EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO6S |
| Net Charge | 0 |
| Average Mass | 263.271 |
| Monoisotopic Mass | 263.04636 |
| SMILES | CNC[C@H](O)c1ccc(OS(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C9H13NO6S/c1-10-5-8(12)6-2-3-9(7(11)4-6)16-17(13,14)15/h2-4,8,10-12H,5H2,1H3,(H,13,14,15)/t8-/m0/s1 |
| InChIKey | AELFRHHZGTVYGJ-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (1993323) | ||
| blood (UBERON:0000178) | PubMed (1993323) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epinephrine sulfate (CHEBI:89878) is a catecholamine (CHEBI:33567) |
| Epinephrine sulfate (CHEBI:89878) is tautomer of (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) |
| Incoming Relation(s) |
| (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) is tautomer of Epinephrine sulfate (CHEBI:89878) |
| Synonyms | Source |
|---|---|
| {2-hydroxy-4-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenyl}oxidanesulfonic acid | HMDB |
| Adrenaline sulfate | HMDB |
| Adrenaline sulphate | HMDB |
| Epinephrine sulfoconjugate | HMDB |
| (R)-4-[1-hydroxy-2-(methylamino)ethyl]-2-Benzenediol mono(hydrogen sulfate) (ester) | HMDB |
| (R)-4-[1-hydroxy-2-(methylamino)ethyl]-2-Benzenediol mono(hydrogen sulphate) (ester) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001876 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77469-50-2 | KEGG COMPOUND |
| Citations |
|---|