EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO6S |
| Net Charge | 0 |
| Average Mass | 263.271 |
| Monoisotopic Mass | 263.04636 |
| SMILES | C[NH2+]C[C@H](O)c1ccc(OS(=O)(=O)[O-])c(O)c1 |
| InChI | InChI=1S/C9H13NO6S/c1-10-5-8(12)6-2-3-9(7(11)4-6)16-17(13,14)15/h2-4,8,10-12H,5H2,1H3,(H,13,14,15)/t8-/m0/s1 |
| InChIKey | AELFRHHZGTVYGJ-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) is a organosulfate oxoanion (CHEBI:58958) |
| (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) is a zwitterion (CHEBI:27369) |
| (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) is tautomer of Epinephrine sulfate (CHEBI:89878) |
| Incoming Relation(s) |
| Epinephrine sulfate (CHEBI:89878) is tautomer of (R)-adrenaline 4'-O-sulfate zwitterion (CHEBI:233043) |
| Synonym | Source |
|---|---|
| L-epinephrine sulfate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (R)-adrenaline 4'-O-sulfate | UniProt |
| Citations |
|---|