EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12F4N2O2S |
| Net Charge | 0 |
| Average Mass | 384.354 |
| Monoisotopic Mass | 384.05556 |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H12F4N2O2S/c1-26(24,25)14-8-6-13(7-9-14)23-15(10-16(22-23)17(19,20)21)11-2-4-12(18)5-3-11/h2-10H,1H3 |
| InChIKey | JHBIMJKLBUMNAU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SC-58125 (CHEBI:8983) has role antineoplastic agent (CHEBI:35610) |
| SC-58125 (CHEBI:8983) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| SC-58125 (CHEBI:8983) is a organofluorine compound (CHEBI:37143) |
| SC-58125 (CHEBI:8983) is a pyrazoles (CHEBI:26410) |
| SC-58125 (CHEBI:8983) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 5-(4-fluorophenyl)-1-[4-(methylsulfonyl)phenyl]-3-(trifluoromethyl)-1H-pyrazole |
| Synonym | Source |
|---|---|
| 1-((4-methylsulfonyl)phenyl)-3-trifluoromethyl-5-(4-fluorophenyl)pyrazole | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7391749 | Reaxys |
| CAS:162054-19-5 | KEGG COMPOUND |
| CAS:162054-19-5 | ChemIDplus |
| Citations |
|---|