EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O |
| Net Charge | 0 |
| Average Mass | 98.145 |
| Monoisotopic Mass | 98.07316 |
| SMILES | [H]C(C)=C([H])C(=O)CC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3,5H,4H2,1-2H3 |
| InChIKey | FEWIGMWODIRUJM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus aurantiifolia (ncbitaxon:159033) | - | PubMed (29942354) | |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (23454028) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hexen-3-one (CHEBI:89801) has role flavouring agent (CHEBI:35617) |
| 4-hexen-3-one (CHEBI:89801) has role human metabolite (CHEBI:77746) |
| 4-hexen-3-one (CHEBI:89801) has role plant metabolite (CHEBI:76924) |
| 4-hexen-3-one (CHEBI:89801) is a enone (CHEBI:51689) |
| Incoming Relation(s) |
| (E)-4-hexen-3-one (CHEBI:183229) is a 4-hexen-3-one (CHEBI:89801) |
| (Z)-4-hexen-3-one (CHEBI:183230) is a 4-hexen-3-one (CHEBI:89801) |
| IUPAC Name |
|---|
| hex-4-en-3-one |
| Synonyms | Source |
|---|---|
| 2-hexen-4-one | ChemIDplus |
| 2-hexene-4-one | ChemIDplus |
| 4-hexene-3-one | ChemIDplus |
| ethyl 1-propenyl ketone | ChEBI |
| FEMA 3352 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FDB013898 | FooDB |
| HMDB0035239 | HMDB |
| Citations |
|---|