EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O |
| Net Charge | 0 |
| Average Mass | 98.145 |
| Monoisotopic Mass | 98.07316 |
| SMILES | C/C=C/C(=O)CC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3,5H,4H2,1-2H3/b5-3+ |
| InChIKey | FEWIGMWODIRUJM-HWKANZROSA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-hexen-3-one (CHEBI:183229) is a 4-hexen-3-one (CHEBI:89801) |
| IUPAC Name |
|---|
| (4E)-hex-4-en-3-one |
| Synonyms | Source |
|---|---|
| (4E)-4-hexen-3-one | ChEBI |
| (E)-2-hexen-4-one | MetaCyc |
| (E)-2-hexene-4-one | MetaCyc |
| (E)-hex-4-en-3-one | ChEBI |
| trans-4-hexen-3-one | ChEBI |
| trans-4-hexene-3-one | ChEBI |
| UniProt Name | Source |
|---|---|
| (E)-4-hexen-3-one | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:50396-87-7 | ChemIDplus |